3(2H)-Isothiazolone,5-[(1-methylethyl)sulfonyl]-4-phenyl- structure
|
Common Name | 3(2H)-Isothiazolone,5-[(1-methylethyl)sulfonyl]-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 64445-68-7 | Molecular Weight | 283.36700 | |
| Density | 1.4g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H13NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-phenyl-5-propan-2-ylsulfonyl-1,2-thiazol-3-one |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Molecular Formula | C12H13NO3S2 |
| Molecular Weight | 283.36700 |
| Exact Mass | 283.03400 |
| PSA | 103.88000 |
| LogP | 3.77860 |
| Index of Refraction | 1.637 |
| InChIKey | ORGUHJBOXDGGRP-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)c1s[nH]c(=O)c1-c1ccccc1 |
|
~%
3(2H)-Isothiazo... CAS#:64445-68-7 |
| Literature: Davis,M. et al. Australian Journal of Chemistry, 1977 , vol. 30, p. 1625 - 1627 |
|
~%
3(2H)-Isothiazo... CAS#:64445-68-7 |
| Literature: Davis,M. et al. Australian Journal of Chemistry, 1977 , vol. 30, p. 1625 - 1627 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |