1-(6,7-Dimethoxy-2-benzofuranyl)ethanone structure
|
Common Name | 1-(6,7-Dimethoxy-2-benzofuranyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 64466-48-4 | Molecular Weight | 220.22100 | |
| Density | 1.184g/cm3 | Boiling Point | 325.9ºC at 760 mmHg | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.9ºC | |
| Name | 1-(6,7-dimethoxy-1-benzofuran-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 325.9ºC at 760 mmHg |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| Flash Point | 150.9ºC |
| Exact Mass | 220.07400 |
| PSA | 48.67000 |
| LogP | 2.65260 |
| Index of Refraction | 1.556 |
| InChIKey | NJYJDKKWBOFQLS-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(C(C)=O)coc2c1OC |
| HS Code | 2932999099 |
|---|
|
~%
1-(6,7-Dimethox... CAS#:64466-48-4 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY; UNIVERSITE DE MONTREAL; LAWRENCE, Michael, R.; MILLER, Michael, M.; SEIFFERT, Dietmar, Alfred; POSY, Shoshana, L.; WONG, Pancras, C.; BANVILLE, Jacques; RUEDIGER, Edward, H.; DEON, Daniel, H.; MARTEL, Alain; TREMBLAY, Francois; GUY, Julia; LAVALLEE, Jean-Francois; GAGNON, Marc Patent: WO2013/163244 A1, 2013 ; Location in patent: Paragraph 00138 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,7-Dimethoxy-2-benzofuranyl methyl ketone |
| KETONE,6,7-DIMETHOXY-2-BENZOFURANYL METHYL |
| 2-Acetyl-6,7-dimethoxy-benzofuran |