1-(7,8-Dimethoxy-2H-1-benzopyran-3-yl)ethanone structure
|
Common Name | 1-(7,8-Dimethoxy-2H-1-benzopyran-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 64466-50-8 | Molecular Weight | 234.24800 | |
| Density | 1.183g/cm3 | Boiling Point | 375.3ºC at 760mmHg | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | 1-(7,8-dimethoxy-2H-chromen-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 375.3ºC at 760mmHg |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.24800 |
| Flash Point | 167.3ºC |
| Exact Mass | 234.08900 |
| PSA | 44.76000 |
| LogP | 2.06860 |
| Index of Refraction | 1.541 |
| InChIKey | VKYNEYMUAOYXPW-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1OC)OCC(C(C)=O)=C2 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-Acetyl-7,8-dimethoxy-2H-chromen |
| KETONE,7,8-DIMETHOXY-2H-1-BENZOPYRAN-3-YL METHYL |
| 7,8-Dimethoxy-2H-1-benzopyran-3-yl methyl ketone |