methyl 2-(4-methyl-3-oxo-1,4-benzothiazin-2-yl)acetate structure
|
Common Name | methyl 2-(4-methyl-3-oxo-1,4-benzothiazin-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 6447-89-8 | Molecular Weight | 251.30200 | |
| Density | 1.251g/cm3 | Boiling Point | 438.6ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.1ºC | |
| Name | methyl 2-(4-methyl-3-oxo-1,4-benzothiazin-2-yl)acetate |
|---|
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 438.6ºC at 760 mmHg |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.30200 |
| Flash Point | 219.1ºC |
| Exact Mass | 251.06200 |
| PSA | 71.91000 |
| LogP | 1.75180 |
| Index of Refraction | 1.572 |
| InChIKey | ZZXIQNATSSDWCS-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1Sc2ccccc2N(C)C1=O |
|
~%
methyl 2-(4-met... CAS#:6447-89-8 |
| Literature: Krapcho; Turk; Piala Journal of medicinal chemistry, 1968 , vol. 11, # 2 p. 361 - 364 |
|
~%
methyl 2-(4-met... CAS#:6447-89-8 |
| Literature: Krapcho; Turk; Piala Journal of medicinal chemistry, 1968 , vol. 11, # 2 p. 361 - 364 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |