4-[[5-amino-1-(4-chlorophenyl)-3-methyl-1H-pyrazol-4-yl]azo]-2,5-dichlorobenzenesulphonic acid, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | 4-[[5-amino-1-(4-chlorophenyl)-3-methyl-1H-pyrazol-4-yl]azo]-2,5-dichlorobenzenesulphonic acid, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 64485-10-5 | Molecular Weight | 565.85800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H23Cl3N6O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-dichloro-4-[(2E)-2-[1-(4-chlorophenyl)-5-imino-3-methylpyrazol-4-ylidene]hydrazinyl]benzenesulfonic acid,2-(2-hydroxyethylamino)ethanol |
|---|
| Molecular Formula | C20H23Cl3N6O5S |
|---|---|
| Molecular Weight | 565.85800 |
| Exact Mass | 564.05200 |
| PSA | 179.08000 |
| LogP | 4.24040 |
| InChIKey | ZGVFOLCZLDJSCD-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c(N)c1N=Nc1cc(Cl)c(S(=O)(=O)O)cc1Cl.OCCNCCO |