1-(3,4,5-TRIMETHOXYPHENYL)-2-THIOUREA
Modify Date: 2025-09-13 04:45:49
1-(3,4,5-TRIMETHOXYPHENYL)-2-THIOUREA structure
|
Common Name | 1-(3,4,5-TRIMETHOXYPHENYL)-2-THIOUREA | ||
|---|---|---|---|---|
| CAS Number | 64488-03-5 | Molecular Weight | 298.12100 | |
| Density | 1.544g/cm3 | Boiling Point | 523.6ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl2NO3 | Melting Point | 222-224ºC | |
| MSDS | N/A | Flash Point | 270.5ºC | |
| Name | 1-[(3,4-dichlorophenyl)methyl]-2-oxopyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.544g/cm3 |
|---|---|
| Boiling Point | 523.6ºC at 760 mmHg |
| Melting Point | 222-224ºC |
| Molecular Formula | C13H9Cl2NO3 |
| Molecular Weight | 298.12100 |
| Flash Point | 270.5ºC |
| Exact Mass | 296.99600 |
| PSA | 59.30000 |
| LogP | 2.90160 |
| Index of Refraction | 1.657 |
| InChIKey | JVAIYFASDWZOSF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccn(Cc2ccc(Cl)c(Cl)c2)c1=O |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| F2153-0009 |
| 1-(3,4-Dichloro-benzyl)-2-oxo-1,2-dihydro-pyridine-3-carboxylic acid |
| 1-(3,4-Dichlorbenzyl)-1,2-dihydro-2-oxo-nicotinsaeure |
| 1-(3,4-Dichlorobenzyl)-2-Oxo-1,2-Dihydro-3-Pyridinecarboxylic Acid |