3-[Diethoxy(methyl)silyl]-2-methylpropionic acid ethyl ester structure
|
Common Name | 3-[Diethoxy(methyl)silyl]-2-methylpropionic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6449-52-1 | Molecular Weight | 248.39100 | |
| Density | 0.946g/cm3 | Boiling Point | 263.4ºC at 760 mmHg | |
| Molecular Formula | C11H24O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.1ºC | |
| Name | ethyl 3-[diethoxy(methyl)silyl]-2-methylpropanoate |
|---|
| Density | 0.946g/cm3 |
|---|---|
| Boiling Point | 263.4ºC at 760 mmHg |
| Molecular Formula | C11H24O4Si |
| Molecular Weight | 248.39100 |
| Flash Point | 94.1ºC |
| Exact Mass | 248.14400 |
| PSA | 44.76000 |
| LogP | 2.33060 |
| Index of Refraction | 1.423 |
| InChIKey | ASVMNQXNLTVYGN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C[Si](C)(OCC)OCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |