1-(4-nitrophenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol structure
|
Common Name | 1-(4-nitrophenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 64511-26-8 | Molecular Weight | 357.40400 | |
| Density | 1.254g/cm3 | Boiling Point | 562.9ºC at 760mmHg | |
| Molecular Formula | C19H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.2ºC | |
| Name | 1-(4-nitrophenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol |
|---|
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 562.9ºC at 760mmHg |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.40400 |
| Flash Point | 294.2ºC |
| Exact Mass | 357.16900 |
| PSA | 81.76000 |
| LogP | 2.68280 |
| Index of Refraction | 1.605 |
| InChIKey | YUCVJMDCNFAFMN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCC(O)CN2CCN(c3ccccc3)CC2)cc1 |
|
~%
1-(4-nitropheno... CAS#:64511-26-8 |
| Literature: Connors, Sean P.; Dennis, Paul D.; Gill, Edward W.; Terrar, Derek A. Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1570 - 1577 |
|
~%
1-(4-nitropheno... CAS#:64511-26-8 |
| Literature: Connors, Sean P.; Dennis, Paul D.; Gill, Edward W.; Terrar, Derek A. Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1570 - 1577 |