1(2H)-Pyridineethanol, 2-imino-alpha-((2-nitrophenoxy)methyl)- structure
|
Common Name | 1(2H)-Pyridineethanol, 2-imino-alpha-((2-nitrophenoxy)methyl)- | ||
|---|---|---|---|---|
| CAS Number | 64511-95-1 | Molecular Weight | 289.28700 | |
| Density | 1.32g/cm3 | Boiling Point | 495.1ºC at 760 mmHg | |
| Molecular Formula | C14H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.2ºC | |
| Name | 1-(2-iminopyridin-1-yl)-3-(2-nitrophenoxy)propan-2-ol |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 495.1ºC at 760 mmHg |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.28700 |
| Flash Point | 253.2ºC |
| Exact Mass | 289.10600 |
| PSA | 104.06000 |
| LogP | 1.93860 |
| Index of Refraction | 1.612 |
| InChIKey | XCGKYCVXDILLGA-UHFFFAOYSA-N |
| SMILES | N=c1ccccn1CC(O)COc1ccccc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |