4-[(4-methylbenzyl)amino]benzoic acid
Modify Date: 2025-11-27 20:37:53
![4-[(4-methylbenzyl)amino]benzoic acid Structure](https://image.chemsrc.com/caspic/207/64518-48-5.png)
4-[(4-methylbenzyl)amino]benzoic acid structure
|
Common Name | 4-[(4-methylbenzyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 64518-48-5 | Molecular Weight | 241.28500 | |
| Density | 1.216g/cm3 | Boiling Point | 428.3ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.8ºC | |
| Name | 4-[(4-methylphenyl)methylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 428.3ºC at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 212.8ºC |
| Exact Mass | 241.11000 |
| PSA | 49.33000 |
| LogP | 3.37830 |
| Index of Refraction | 1.647 |
| InChIKey | PSQNWDZFOPXXAN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CNc2ccc(C(=O)O)cc2)cc1 |
| HS Code | 2922499990 |
|---|
|
~%
4-[(4-methylben... CAS#:64518-48-5 |
| Literature: Dow Chemical Patent: DE2701854 , 1977 ; Chem.Abstr., 1977 , vol. 87, # 184224 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| hms1510a09 |