methyl 2-[(3,4,5-triethoxybenzoyl)carbamothioylamino]benzoate structure
|
Common Name | methyl 2-[(3,4,5-triethoxybenzoyl)carbamothioylamino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 6453-51-6 | Molecular Weight | 446.51700 | |
| Density | 1.247g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H26N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[(3,4,5-triethoxybenzoyl)carbamothioylamino]benzoate |
|---|
| Density | 1.247g/cm3 |
|---|---|
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.51700 |
| Exact Mass | 446.15100 |
| PSA | 137.74000 |
| LogP | 4.59140 |
| Index of Refraction | 1.597 |
| InChIKey | AOXCKKIPPMPFOI-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2ccccc2C(=O)OC)cc(OCC)c1OCC |
|
~%
methyl 2-[(3,4,... CAS#:6453-51-6 |
| Literature: Fujimoto; Sakai Chemical and pharmaceutical bulletin, 1966 , vol. 14, # 3 p. 280 - 284 |
|
~%
methyl 2-[(3,4,... CAS#:6453-51-6 |
| Literature: Fujimoto; Sakai Chemical and pharmaceutical bulletin, 1966 , vol. 14, # 3 p. 280 - 284 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |