6-amino-3-ethyl-4-[5-(4-fluorophenyl)furan-2-yl]-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile structure
|
Common Name | 6-amino-3-ethyl-4-[5-(4-fluorophenyl)furan-2-yl]-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 6458-70-4 | Molecular Weight | 350.34600 | |
| Density | 1.43g/cm3 | Boiling Point | 601ºC at 760 mmHg | |
| Molecular Formula | C19H15FN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.3ºC | |
| Name | 6-amino-3-ethyl-4-[5-(4-fluorophenyl)furan-2-yl]-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 601ºC at 760 mmHg |
| Molecular Formula | C19H15FN4O2 |
| Molecular Weight | 350.34600 |
| Flash Point | 317.3ºC |
| Exact Mass | 350.11800 |
| PSA | 100.86000 |
| LogP | 4.28968 |
| Index of Refraction | 1.667 |
| InChIKey | BIMDOACUMVBZTC-UHFFFAOYSA-N |
| SMILES | CCc1[nH]nc2c1C(c1ccc(-c3ccc(F)cc3)o1)C(C#N)=C(N)O2 |
|
~%
6-amino-3-ethyl... CAS#:6458-70-4 |
| Literature: Fujimoto; Sakai Chemical and pharmaceutical bulletin, 1966 , vol. 14, # 3 p. 280 - 284 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |