1-methoxy-2-(4-nitrophenyl)benzene
1-methoxy-2-(4-nitrophenyl)benzene structure
|
Common Name | 1-methoxy-2-(4-nitrophenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 6460-91-9 | Molecular Weight | 229.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Methoxy-2-(4-nitrophenyl)benzene (Chinese name: 1-甲氧基-2-(4-硝基苯基)苯，CAS number: 6460-91-9，molecular formula: C13H11NO3，molecular weight: 229.23100)，for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methoxy-2-(4-nitrophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11NO3 |
|---|---|
| Molecular Weight | 229.23100 |
| Exact Mass | 229.07400 |
| PSA | 55.05000 |
| LogP | 3.79360 |
| InChIKey | ABSAJMFYUWSMPL-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-c1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 2 | |
CAS#:5720-06-9
CAS#:586-78-7
CAS#:100-01-6
CAS#:636-98-6
CAS#:100-66-3
CAS#:100-00-5
CAS#:335343-05-0
CAS#:6535-18-8
CAS#:578-57-4
CAS#:937-31-5
CAS#:263901-48-0
CAS#:666726-32-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4'-Nitro-2-methoxy-biphenyl |
| 2-methoxy-4'-nitro-1,1'-biphenyl |
| 2'-methoxy-4-nitrobiphenyl |
| 1,1'-Biphenyl,2-methoxy-4'-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 1-methoxy-2-(4-nitrophenyl)benzene? |
| A: Related upstream materials(CAS) of 1-methoxy-2-(4-nitrophenyl)benzene: 5720-06-9;586-78-7;100-01-6;636-98-6;100-66-3;100-00-5;335343-05-0;6535-18-8;578-57-4;937-31-5. |
| Q: What is the SMILES notation of 1-methoxy-2-(4-nitrophenyl)benzene? |
| A: SMILES notation of 1-methoxy-2-(4-nitrophenyl)benzene is COc1ccccc1-c1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular formula of 1-methoxy-2-(4-nitrophenyl)benzene? |
| A: Molecular formula of 1-methoxy-2-(4-nitrophenyl)benzene is C13H11NO3. |
| Q: What is the polar surface area (PSA) of 1-methoxy-2-(4-nitrophenyl)benzene? |
| A: Polar surface area (PSA) of 1-methoxy-2-(4-nitrophenyl)benzene is 55.05000. |
| Q: What is the English name of 1-methoxy-2-(4-nitrophenyl)benzene? |
| A: The English name of 1-methoxy-2-(4-nitrophenyl)benzene is 1-methoxy-2-(4-nitrophenyl)benzene. |
| Q: What is the CAS number of 1-methoxy-2-(4-nitrophenyl)benzene? |
| A: CAS number of 1-methoxy-2-(4-nitrophenyl)benzene is 6460-91-9. |
| Q: What is the LogP of 1-methoxy-2-(4-nitrophenyl)benzene? |
| A: LogP of 1-methoxy-2-(4-nitrophenyl)benzene is 3.79360. |
| Q: What English synonyms does 1-methoxy-2-(4-nitrophenyl)benzene have? |
| A: English synonyms of 1-methoxy-2-(4-nitrophenyl)benzene: 4'-Nitro-2-methoxy-biphenyl, 2-methoxy-4'-nitro-1,1'-biphenyl, 2'-methoxy-4-nitrobiphenyl, 1,1'-Biphenyl,2-methoxy-4'-nitro. |
| Q: What is the molecular weight of 1-methoxy-2-(4-nitrophenyl)benzene? |
| A: Molecular weight of 1-methoxy-2-(4-nitrophenyl)benzene is 229.23100. |
| Q: What is the InChIKey of 1-methoxy-2-(4-nitrophenyl)benzene? |
| A: InChIKey of 1-methoxy-2-(4-nitrophenyl)benzene is ABSAJMFYUWSMPL-UHFFFAOYSA-N. |