3-(ditert-butylphosphanylmethyl)phenol structure
|
Common Name | 3-(ditert-butylphosphanylmethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 646069-73-0 | Molecular Weight | 252.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H25OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(ditert-butylphosphanylmethyl)phenol |
|---|
| Molecular Formula | C15H25OP |
|---|---|
| Molecular Weight | 252.33200 |
| Exact Mass | 252.16400 |
| PSA | 33.82000 |
| LogP | 4.97110 |
| InChIKey | CJLSSFZDVHOPPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(Cc1cccc(O)c1)C(C)(C)C |
|
~99%
3-(ditert-butyl... CAS#:646069-73-0 |
| Literature: Eberhard, Michael R.; Matsukawa, Shiro; Yamamoto, Yohsuke; Jensen, Craig M. Journal of Organometallic Chemistry, 2003 , vol. 687, # 1 p. 185 - 189 |
|
~%
3-(ditert-butyl... CAS#:646069-73-0 |
| Literature: Eberhard, Michael R.; Matsukawa, Shiro; Yamamoto, Yohsuke; Jensen, Craig M. Journal of Organometallic Chemistry, 2003 , vol. 687, # 1 p. 185 - 189 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |