N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide structure
|
Common Name | N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 6461-15-0 | Molecular Weight | 475.02300 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H23ClN2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C23H23ClN2O3S2 |
| Molecular Weight | 475.02300 |
| Exact Mass | 474.08400 |
| PSA | 103.65000 |
| LogP | 7.24300 |
| Index of Refraction | 1.668 |
| InChIKey | UBSQKKXIGLWBLB-UHFFFAOYSA-N |
| SMILES | CSc1ccc(S(=O)(=O)N(CC(=O)Nc2cc(Cl)ccc2C)c2ccc(C)cc2)cc1 |
|
~%
N-(5-chloro-2-m... CAS#:6461-15-0 |
| Literature: Erlanger et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 1806,1809 |
|
~%
N-(5-chloro-2-m... CAS#:6461-15-0 |
| Literature: Schwyzer; Sieber Helvetica Chimica Acta, 1957 , vol. 40, p. 624,635 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |