N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide
N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide structure
|
Common Name | N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 6461-15-0 | Molecular Weight | 475.02300 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H23ClN2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(5-Chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide, CAS号6461-15-0, molecular formula C23H23ClN2O3S2, molecular weight 475.02300, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C23H23ClN2O3S2 |
| Molecular Weight | 475.02300 |
| Exact Mass | 474.08400 |
| PSA | 103.65000 |
| LogP | 7.24300 |
| Index of Refraction | 1.668 |
| InChIKey | UBSQKKXIGLWBLB-UHFFFAOYSA-N |
| SMILES | CSc1ccc(S(=O)(=O)N(CC(=O)Nc2cc(Cl)ccc2C)c2ccc(C)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(5-chloro-2-m... CAS#:6461-15-0 |
| Literature: Erlanger et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 1806,1809 |
|
~%
N-(5-chloro-2-m... CAS#:6461-15-0 |
| Literature: Schwyzer; Sieber Helvetica Chimica Acta, 1957 , vol. 40, p. 624,635 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide? |
| A: InChIKey of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide is UBSQKKXIGLWBLB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide? |
| A: Molecular formula of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide is C23H23ClN2O3S2. |
| Q: What is the polar surface area (PSA) of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide? |
| A: Polar surface area (PSA) of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide is 103.65000. |
| Q: What is the Chinese name of 6461-15-0? |
| A: Chinese name of 6461-15-0 is 6461-15-0. |
| Q: What is the molecular weight of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide? |
| A: Molecular weight of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide is 475.02300. |
| Q: What are the upstream materials of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide? |
| A: Related upstream materials(CAS) of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide: 1149-26-4;10512-93-3;56787-47-4. |
| Q: What is the SMILES notation of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide? |
| A: SMILES notation of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide is CSc1ccc(S(=O)(=O)N(CC(=O)Nc2cc(Cl)ccc2C)c2ccc(C)cc2)cc1. |
| Q: What is the CAS number of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide? |
| A: CAS number of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide is 6461-15-0. |
| Q: What is the English name of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide? |
| A: The English name of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide is N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide. |
| Q: What is the LogP of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide? |
| A: LogP of N-(5-chloro-2-methylphenyl)-2-(4-methyl-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide is 7.24300. |