a-D-Ribofuranoside, methyl2,3-anhydro-, 4-nitrobenzoate (9CI) structure
|
Common Name | a-D-Ribofuranoside, methyl2,3-anhydro-, 4-nitrobenzoate (9CI) | ||
|---|---|---|---|---|
| CAS Number | 64623-08-1 | Molecular Weight | 295.24500 | |
| Density | 1.45g/cm3 | Boiling Point | 457ºC at 760mmHg | |
| Molecular Formula | C13H13NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.1ºC | |
| Name | 2-methyl-3-oxo-3-(2,4,6-trimethylphenyl)propanoic acid |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 457ºC at 760mmHg |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.24500 |
| Flash Point | 208.1ºC |
| Exact Mass | 295.06900 |
| PSA | 103.11000 |
| LogP | 1.41350 |
| InChIKey | QQJDGDHKWDVQPR-UHFFFAOYSA-N |
| SMILES | COC1OC(COC(=O)c2ccc([N+](=O)[O-])cc2)C2OC12 |
|
~%
a-D-Ribofuranos... CAS#:64623-08-1 |
| Literature: Anderson et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 5247,5250 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |