4-cyano-2-(phenylmethoxycarbonylamino)benzoic acid structure
|
Common Name | 4-cyano-2-(phenylmethoxycarbonylamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 64630-01-9 | Molecular Weight | 296.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-cyano-2-(phenylmethoxycarbonylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12N2O4 |
|---|---|
| Molecular Weight | 296.27700 |
| Exact Mass | 296.08000 |
| PSA | 102.91000 |
| LogP | 3.01878 |
| InChIKey | HJQNBDCIWPCIFO-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(=O)O)c(NC(=O)OCc2ccccc2)c1 |
|
~%
4-cyano-2-(phen... CAS#:64630-01-9 |
| Literature: Chan,R.L.; Bruice,T.C. Journal of the American Chemical Society, 1977 , vol. 99, p. 6721 - 6730 |
|
~%
4-cyano-2-(phen... CAS#:64630-01-9 |
| Literature: Chan,R.L.; Bruice,T.C. Journal of the American Chemical Society, 1977 , vol. 99, p. 6721 - 6730 |
|
~%
4-cyano-2-(phen... CAS#:64630-01-9 |
| Literature: Chan,R.L.; Bruice,T.C. Journal of the American Chemical Society, 1977 , vol. 99, p. 6721 - 6730 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Cyano-N-benzyloxycarbonylanthranilsaeure |