2-hydroxy-4-(2-oxochromen-7-yl)oxybutanenitrile structure
|
Common Name | 2-hydroxy-4-(2-oxochromen-7-yl)oxybutanenitrile | ||
|---|---|---|---|---|
| CAS Number | 646507-35-9 | Molecular Weight | 245.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-4-(2-oxochromen-7-yl)oxybutanenitrile |
|---|
| Molecular Formula | C13H11NO4 |
|---|---|
| Molecular Weight | 245.23100 |
| Exact Mass | 245.06900 |
| PSA | 83.46000 |
| LogP | 1.44638 |
| InChIKey | XNGGCZMNISWJEH-UHFFFAOYSA-N |
| SMILES | N#CC(O)CCOc1ccc2ccc(=O)oc2c1 |
|
~%
2-hydroxy-4-(2-... CAS#:646507-35-9 |
| Literature: Leroy, Emmanuel; Bensel, Nicolas; Reymond, Jean-Louis Advanced Synthesis and Catalysis, 2003 , vol. 345, # 6-7 p. 859 - 865 |
|
~%
2-hydroxy-4-(2-... CAS#:646507-35-9 |
| Literature: Leroy, Emmanuel; Bensel, Nicolas; Reymond, Jean-Louis Advanced Synthesis and Catalysis, 2003 , vol. 345, # 6-7 p. 859 - 865 |