3-[2-(Diproplyamino)ethyl]phenol hydrobromide structure
|
Common Name | 3-[2-(Diproplyamino)ethyl]phenol hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 64656-40-2 | Molecular Weight | 302.25000 | |
| Density | N/A | Boiling Point | 336.4ºC at 760mmHg | |
| Molecular Formula | C14H24BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.9ºC | |
| Name | 3-[2-(dipropylamino)ethyl]phenol,hydrobromide |
|---|
| Boiling Point | 336.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H24BrNO |
| Molecular Weight | 302.25000 |
| Flash Point | 145.9ºC |
| Exact Mass | 301.10400 |
| PSA | 23.47000 |
| LogP | 4.01480 |
| InChIKey | KUEBTNOIRGMQAG-UHFFFAOYSA-N |
| SMILES | Br.CCCN(CCC)CCc1cccc(O)c1 |
|
Name: Stimulation of dopamine receptor in sc dosed Sprague-Dawley rat assessed as reduction...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3252993
|
|
Name: Effect on motor activity in reserpinized Sprague-Dawley rat assessed as stereotyped m...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3252995
|
|
Name: Stimulation of dopamine receptor in sc dosed Sprague-Dawley rat assessed as reduction...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3252994
|
|
Name: Effect on motor activity in reserpinized Sprague-Dawley rat assessed as stereotyped m...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3252996
|