diethyl 2-(3,4-dimethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate structure
|
Common Name | diethyl 2-(3,4-dimethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 64670-39-9 | Molecular Weight | 408.44200 | |
| Density | 1.205g/cm3 | Boiling Point | 531.3ºC at 760mmHg | |
| Molecular Formula | C21H28O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.6ºC | |
| Name | diethyl 2-(3,4-dimethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 531.3ºC at 760mmHg |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.44200 |
| Flash Point | 178.6ºC |
| Exact Mass | 408.17800 |
| PSA | 108.36000 |
| LogP | 1.86980 |
| Index of Refraction | 1.519 |
| InChIKey | SSFQCYJOBBZRIP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(=O)CC(C)(O)C(C(=O)OCC)C1c1ccc(OC)c(OC)c1 |
|
~%
diethyl 2-(3,4-... CAS#:64670-39-9 |
| Literature: Horning; Horning Journal of the American Chemical Society, 1947 , vol. 69, p. 1359 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |