1-Propanone,1-[1,3-dihydroxy-4-[(2-hydroxyphenyl)methyl]-9H-xanthen-2-yl]-3-phenyl- structure
|
Common Name | 1-Propanone,1-[1,3-dihydroxy-4-[(2-hydroxyphenyl)methyl]-9H-xanthen-2-yl]-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 64675-27-0 | Molecular Weight | 452.49800 | |
| Density | 1.328g/cm3 | Boiling Point | 707.3ºC at 760 mmHg | |
| Molecular Formula | C29H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.5ºC | |
| Name | chamuvaritin i |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 707.3ºC at 760 mmHg |
| Molecular Formula | C29H24O5 |
| Molecular Weight | 452.49800 |
| Flash Point | 240.5ºC |
| Exact Mass | 452.16200 |
| PSA | 86.99000 |
| LogP | 5.90620 |
| Index of Refraction | 1.685 |
| InChIKey | IWPNHPPGEPHKBZ-UHFFFAOYSA-N |
| SMILES | O=C(CCc1ccccc1)c1c(O)c(Cc2ccccc2O)c2c(c1O)Cc1ccccc1O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| chamuvaritin |