5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole
Modify Date: 2026-08-02 18:38:13
5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole structure
|
Common Name | 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole | ||
|---|---|---|---|---|
| CAS Number | 64686-59-5 | Molecular Weight | 217.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15NO2 |
|---|---|
| Molecular Weight | 217.26400 |
| Exact Mass | 217.11000 |
| PSA | 35.26000 |
| LogP | 3.47360 |
| InChIKey | LACMOYLANXPRBV-UHFFFAOYSA-N |
| SMILES | COc1oc(-c2ccccc2)nc1C(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:64686-53-9This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole? |
| A: Related downstream products(CAS) of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole: 64686-53-9. |
| Q: What is the Chinese name of 64686-59-5? |
| A: Chinese name of 64686-59-5 is 64686-59-5. |
| Q: What is the LogP of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole? |
| A: LogP of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole is 3.47360. |
| Q: What is the SMILES notation of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole? |
| A: SMILES notation of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole is COc1oc(-c2ccccc2)nc1C(C)C. |
| Q: What is the molecular formula of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole? |
| A: Molecular formula of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole is C13H15NO2. |
| Q: What is the English name of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole? |
| A: The English name of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole is 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole. |
| Q: What is the polar surface area (PSA) of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole? |
| A: Polar surface area (PSA) of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole is 35.26000. |
| Q: What is the molecular weight of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole? |
| A: Molecular weight of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole is 217.26400. |
| Q: What is the InChIKey of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole? |
| A: InChIKey of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole is LACMOYLANXPRBV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole? |
| A: CAS number of 5-methoxy-2-phenyl-4-propan-2-yl-1,3-oxazole is 64686-59-5. |