2-(4-chlorophenyl)sulfanylbenzoyl chloride
2-(4-chlorophenyl)sulfanylbenzoyl chloride structure
|
Common Name | 2-(4-chlorophenyl)sulfanylbenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 6469-86-9 | Molecular Weight | 283.17300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Cl2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-chlorophenyl)sulfanylbenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H8Cl2OS |
|---|---|
| Molecular Weight | 283.17300 |
| Exact Mass | 281.96700 |
| PSA | 42.37000 |
| LogP | 4.87020 |
| InChIKey | YJTOJHAJIVPOQK-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccccc1Sc1ccc(Cl)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:41932-35-8![[2-(4-chlorophenyl)sulfanylphenyl]methanol structure](https://image.chemsrc.com/caspic/187/13459-59-1.png)
CAS#:13459-59-1![Benzoic acid,2-[(4-chlorophenyl)thio] structure](https://image.chemsrc.com/caspic/464/6469-85-8.png)
CAS#:6469-85-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Chlor-2'-chlorformyl-diphenylsulfid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(4-chlorophenyl)sulfanylbenzoyl chloride? |
| A: InChIKey of 2-(4-chlorophenyl)sulfanylbenzoyl chloride is YJTOJHAJIVPOQK-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-(4-chlorophenyl)sulfanylbenzoyl chloride? |
| A: LogP of 2-(4-chlorophenyl)sulfanylbenzoyl chloride is 4.87020. |
| Q: What English synonyms does 2-(4-chlorophenyl)sulfanylbenzoyl chloride have? |
| A: English synonyms of 2-(4-chlorophenyl)sulfanylbenzoyl chloride: 4-Chlor-2'-chlorformyl-diphenylsulfid. |
| Q: What is the English name of 2-(4-chlorophenyl)sulfanylbenzoyl chloride? |
| A: The English name of 2-(4-chlorophenyl)sulfanylbenzoyl chloride is 2-(4-chlorophenyl)sulfanylbenzoyl chloride. |
| Q: What are the downstream products of 2-(4-chlorophenyl)sulfanylbenzoyl chloride? |
| A: Related downstream products(CAS) of 2-(4-chlorophenyl)sulfanylbenzoyl chloride: 41932-35-8;13459-59-1;6469-85-8. |
| Q: What is the molecular weight of 2-(4-chlorophenyl)sulfanylbenzoyl chloride? |
| A: Molecular weight of 2-(4-chlorophenyl)sulfanylbenzoyl chloride is 283.17300. |
| Q: What is the molecular formula of 2-(4-chlorophenyl)sulfanylbenzoyl chloride? |
| A: Molecular formula of 2-(4-chlorophenyl)sulfanylbenzoyl chloride is C13H8Cl2OS. |
| Q: What is the CAS number of 2-(4-chlorophenyl)sulfanylbenzoyl chloride? |
| A: CAS number of 2-(4-chlorophenyl)sulfanylbenzoyl chloride is 6469-86-9. |
| Q: What is the polar surface area (PSA) of 2-(4-chlorophenyl)sulfanylbenzoyl chloride? |
| A: Polar surface area (PSA) of 2-(4-chlorophenyl)sulfanylbenzoyl chloride is 42.37000. |
| Q: What is the SMILES notation of 2-(4-chlorophenyl)sulfanylbenzoyl chloride? |
| A: SMILES notation of 2-(4-chlorophenyl)sulfanylbenzoyl chloride is O=C(Cl)c1ccccc1Sc1ccc(Cl)cc1. |