1-(1,2,3,5,6,7-Hexahydro-s-indacen-4-yl)-piperazine; compound with (Z)-but-2-enedioic acid structure
|
Common Name | 1-(1,2,3,5,6,7-Hexahydro-s-indacen-4-yl)-piperazine; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 64695-71-2 | Molecular Weight | 358.43100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1,2,3,5,6,7-Hexahydro-s-indacen-4-yl)-piperazine; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C20H26N2O4 |
|---|---|
| Molecular Weight | 358.43100 |
| Exact Mass | 358.18900 |
| PSA | 89.87000 |
| LogP | 2.17920 |
| InChIKey | LWZCHIYFORLWJE-WLHGVMLRSA-N |
| SMILES | O=C(O)C=CC(=O)O.c1c2c(c(N3CCNCC3)c3c1CCC3)CCC2 |