1-Chloro-5-methoxy-4-nitro-2-(trifluoromethyl)benzene structure
|
Common Name | 1-Chloro-5-methoxy-4-nitro-2-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 646989-36-8 | Molecular Weight | 255.578 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 291.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H5ClF3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.9±27.3 °C | |
| Name | 1-Chloro-5-methoxy-4-nitro-2-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 291.3±40.0 °C at 760 mmHg |
| Molecular Formula | C8H5ClF3NO3 |
| Molecular Weight | 255.578 |
| Flash Point | 129.9±27.3 °C |
| Exact Mass | 254.991013 |
| PSA | 55.05000 |
| LogP | 4.12 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | ULCYZNNAMJNPMX-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)c(C(F)(F)F)cc1[N+](=O)[O-] |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1-chloro-5-methoxy-4-nitro-2-(trifluoromethyl)- |
| 1-Chloro-5-methoxy-4-nitro-2-(trifluoromethyl)benzene |
| 2-Chloro-4-methoxy-5-nitrobenzotrifluoride |