4,4-diethoxybut-2-ynylselanylbenzene structure
|
Common Name | 4,4-diethoxybut-2-ynylselanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 647009-99-2 | Molecular Weight | 297.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4-diethoxybut-2-ynylselanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O2Se |
|---|---|
| Molecular Weight | 297.25200 |
| Exact Mass | 298.04700 |
| PSA | 18.46000 |
| LogP | 1.83690 |
| InChIKey | DIWUPALBPPKTGZ-UHFFFAOYSA-N |
| SMILES | CCOC(C#CC[Se]c1ccccc1)OCC |
|
~%
4,4-diethoxybut... CAS#:647009-99-2 |
| Literature: Yoshimatsu, Mitsuhiro; Matsuura, Yasutaka; Gotoh, Kohei Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 12 p. 1405 - 1412 |
|
~%
4,4-diethoxybut... CAS#:647009-99-2 |
| Literature: Yoshimatsu, Mitsuhiro; Matsuura, Yasutaka; Gotoh, Kohei Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 12 p. 1405 - 1412 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-benzeneselenenylbut-2-ynal diethyl acetal |