5-phenyl-4-phenylselanyl-3-phenylsulfanylpenta-2,4-dienal structure
|
Common Name | 5-phenyl-4-phenylselanyl-3-phenylsulfanylpenta-2,4-dienal | ||
|---|---|---|---|---|
| CAS Number | 647010-43-3 | Molecular Weight | 421.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H18OSSe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-phenyl-4-phenylselanyl-3-phenylsulfanylpenta-2,4-dienal |
|---|
| Molecular Formula | C23H18OSSe |
|---|---|
| Molecular Weight | 421.41300 |
| Exact Mass | 422.02400 |
| PSA | 42.37000 |
| LogP | 4.93230 |
| InChIKey | XSZNFSAJSKLNRH-UHFFFAOYSA-N |
| SMILES | O=CC=C(Sc1ccccc1)C(=Cc1ccccc1)[Se]c1ccccc1 |
|
~75%
5-phenyl-4-phen... CAS#:647010-43-3 |
| Literature: Yoshimatsu, Mitsuhiro; Matsuura, Yasutaka; Gotoh, Kohei Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 12 p. 1405 - 1412 |
|
~%
5-phenyl-4-phen... CAS#:647010-43-3 |
| Literature: Yoshimatsu, Mitsuhiro; Matsuura, Yasutaka; Gotoh, Kohei Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 12 p. 1405 - 1412 |
|
~%
5-phenyl-4-phen... CAS#:647010-43-3 |
| Literature: Yoshimatsu, Mitsuhiro; Matsuura, Yasutaka; Gotoh, Kohei Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 12 p. 1405 - 1412 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |