Propanoic acid,2,2-dimethyl-, 1,3-benzodioxol-5-ylmethyl ester
Modify Date: 2025-09-21 18:15:38
Propanoic acid,2,2-dimethyl-, 1,3-benzodioxol-5-ylmethyl ester structure
|
Common Name | Propanoic acid,2,2-dimethyl-, 1,3-benzodioxol-5-ylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6471-96-1 | Molecular Weight | 236.26400 | |
| Density | 1.163g/cm3 | Boiling Point | 310.1ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.3ºC | |
| Name | 1,3-benzodioxol-5-ylmethyl 2,2-dimethylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 310.1ºC at 760 mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 133.3ºC |
| Exact Mass | 236.10500 |
| PSA | 44.76000 |
| LogP | 2.50460 |
| Index of Refraction | 1.525 |
| InChIKey | QIKMSBWNVVQENG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OCc1ccc2c(c1)OCO2 |
| HS Code | 2932999099 |
|---|
|
~%
Propanoic acid,... CAS#:6471-96-1 |
| Literature: Barthel; Gertler U.S. Dep. Agric. ARS, 33-27 <1956> 1,3 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Pivaloyloxymethyl-benzo[1,3]dioxol |
| 1,3-Benzodioxol-5-ylmethyl pivalate |
| EINECS 229-320-0 |
| 5-pivaloyloximethyl-benzo[1,3]dioxole |