Benzenesulfonamide,4-chloro-N,N-bis(2-chloroethyl)- structure
|
Common Name | Benzenesulfonamide,4-chloro-N,N-bis(2-chloroethyl)- | ||
|---|---|---|---|---|
| CAS Number | 6472-49-7 | Molecular Weight | 316.63200 | |
| Density | 1.421g/cm3 | Boiling Point | 421.7ºC at 760mmHg | |
| Molecular Formula | C10H12Cl3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.8ºC | |
| Name | 4-Chlor-benzolsulfonsaeure-<2.2'-dichlor-diaethylamid> |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 421.7ºC at 760mmHg |
| Molecular Formula | C10H12Cl3NO2S |
| Molecular Weight | 316.63200 |
| Flash Point | 208.8ºC |
| Exact Mass | 314.96500 |
| PSA | 45.76000 |
| LogP | 3.88910 |
| Index of Refraction | 1.564 |
| InChIKey | AJLVKGRYFBRBOK-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N(CCCl)CCCl |
|
~%
Benzenesulfonam... CAS#:6472-49-7 |
| Literature: Kretow; Tichonowa Zhurnal Obshchei Khimii, 1958 , vol. 28, p. 2802,2811;engl.Ausg.S.2832,2834 |
|
~%
Benzenesulfonam... CAS#:6472-49-7 |
| Literature: Ross; Wilson Journal of the Chemical Society, 1959 , p. 3616,3618 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 8-quinolyl 4-chlorobenzenesulfonate |