Benzeneacetic acid,-alpha--(hydroxymethyl)-4-(2-methylpropyl)- (9CI)
Modify Date: 2025-09-19 16:56:04
Benzeneacetic acid,-alpha--(hydroxymethyl)-4-(2-methylpropyl)- (9CI) structure
|
Common Name | Benzeneacetic acid,-alpha--(hydroxymethyl)-4-(2-methylpropyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 64730-72-9 | Molecular Weight | 222.28000 | |
| Density | 1.123g/cm3 | Boiling Point | 370ºC at 760 mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.7ºC | |
| Name | 3-hydroxy-2-[4-(2-methylpropyl)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 370ºC at 760 mmHg |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Flash Point | 191.7ºC |
| Exact Mass | 222.12600 |
| PSA | 57.53000 |
| LogP | 2.04560 |
| Index of Refraction | 1.542 |
| InChIKey | GSVPDLNMVPXACN-UHFFFAOYSA-N |
| SMILES | CC(C)Cc1ccc(C(CO)C(=O)O)cc1 |
| HS Code | 2918199090 |
|---|
|
~37%
Benzeneacetic a... CAS#:64730-72-9 |
| Literature: Fisnerova, Ludmila; Rabek, Vlastimil; Nemecek, Oldrich Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 3 p. 901 - 905 |
|
~%
Benzeneacetic a... CAS#:64730-72-9 |
| Literature: Fisnerova, Ludmila; Rabek, Vlastimil; Nemecek, Oldrich Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 3 p. 901 - 905 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p-isobutyl-2-phenyl-3-hydroxypropane acid |