2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-hydrazinylheptan-1-ol structure
|
Common Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-hydrazinylheptan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 64739-15-7 | Molecular Weight | 380.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5F13N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-hydrazinylheptan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5F13N2O |
|---|---|
| Molecular Weight | 380.10700 |
| Exact Mass | 380.01900 |
| PSA | 58.28000 |
| LogP | 3.59810 |
| InChIKey | XMAJYENAUFJTSZ-UHFFFAOYSA-N |
| SMILES | NNC(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
2,2,3,3,4,4,5,5... CAS#:64739-15-7 |
| Literature: Knunyants,I.L.; Bargamova,M.D. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1977 , vol. 26, # 8 p. 1780 - 1782 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1977 , vol. 26, # 8 p. 1916 - 1918 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Heptanol,2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-hydrazino |
| 1H,1H-tridecafluoro-1-hydrazino-heptan-1-ol |