ethyl 3-bromo-2-oxo-3-phenylpropanoate structure
|
Common Name | ethyl 3-bromo-2-oxo-3-phenylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 6476-17-1 | Molecular Weight | 271.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-bromo-2-oxo-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11BrO3 |
|---|---|
| Molecular Weight | 271.10700 |
| Exact Mass | 269.98900 |
| PSA | 43.37000 |
| LogP | 2.25480 |
| InChIKey | QXIHQDOUUDXWFX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C(Br)c1ccccc1 |
| HS Code | 2918300090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl 3-bromo-2-oxo-3-phenylpropanoate |
| ethyl 3-bromo-2-oxo-3-phenylpropionate |
| Brom-phenyl-brenztraubensaeure-aethylester |
| ethyl 3-bromo-3-phenylpyruvate |
| bromo-phenyl-pyruvic acid ethyl ester |