(4-methoxyphenyl)-tris(prop-2-enyl)silane structure
|
Common Name | (4-methoxyphenyl)-tris(prop-2-enyl)silane | ||
|---|---|---|---|---|
| CAS Number | 647842-35-1 | Molecular Weight | 258.43100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methoxyphenyl)-tris(prop-2-enyl)silane |
|---|
| Molecular Formula | C16H22OSi |
|---|---|
| Molecular Weight | 258.43100 |
| Exact Mass | 258.14400 |
| PSA | 9.23000 |
| LogP | 3.90900 |
| InChIKey | UYHKMSCORYZYOG-UHFFFAOYSA-N |
| SMILES | C=CC[Si](CC=C)(CC=C)c1ccc(OC)cc1 |
|
~%
(4-methoxypheny... CAS#:647842-35-1 |
| Literature: Sahoo, Akhila K.; Oda, Takuro; Nakao, Yoshiaki; Hiyama, Tamejiro Advanced Synthesis and Catalysis, 2004 , vol. 346, # 13-15 p. 1715 - 1727 |
|
~%
(4-methoxypheny... CAS#:647842-35-1 |
| Literature: Sahoo, Akhila K.; Oda, Takuro; Nakao, Yoshiaki; Hiyama, Tamejiro Advanced Synthesis and Catalysis, 2004 , vol. 346, # 13-15 p. 1715 - 1727 |
| Precursor 3 | |
|---|---|
| DownStream 8 | |