2-[2-(hydroxymethyl)phenyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide structure
|
Common Name | 2-[2-(hydroxymethyl)phenyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 64795-09-1 | Molecular Weight | 308.37400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(hydroxymethyl)phenyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|
| Molecular Formula | C19H20N2O2 |
|---|---|
| Molecular Weight | 308.37400 |
| Exact Mass | 308.15200 |
| PSA | 68.61000 |
| LogP | 3.40190 |
| InChIKey | YVEZQKSCDIRQHQ-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1CO)NCCc1c[nH]c2ccccc12 |
|
~80%
2-[2-(hydroxyme... CAS#:64795-09-1 |
| Literature: Chatterjee, Asima; Ghosh, Somnath Synthesis, 1981 , # 10 p. 818 - 820 |
|
~%
2-[2-(hydroxyme... CAS#:64795-09-1 |
| Literature: Swan Journal of the Chemical Society, 1949 , p. 1723 Journal of the Chemical Society, 1958 , p. 2038,2039 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |