D-Val-Leu-Arg p-nitroanilide diacetate salt structure
|
Common Name | D-Val-Leu-Arg p-nitroanilide diacetate salt | ||
|---|---|---|---|---|
| CAS Number | 64816-14-4 | Molecular Weight | 506.59800 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H38N8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of D-Val-Leu-Arg p-nitroanilide diacetate saltD-Val-Leu-Arg-pNA is a glandular kininoreleasing enzyme substrate that also acts as a substrate for tissue-type plasminogen activator (t-PA) with no apparent affinity for fibrin[1]. |
| Name | (2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]-4-methylpentanamide |
|---|---|
| Synonym | More Synonyms |
| Description | D-Val-Leu-Arg-pNA is a glandular kininoreleasing enzyme substrate that also acts as a substrate for tissue-type plasminogen activator (t-PA) with no apparent affinity for fibrin[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.34g/cm3 |
|---|---|
| Molecular Formula | C23H38N8O5 |
| Molecular Weight | 506.59800 |
| Exact Mass | 506.29700 |
| PSA | 228.02000 |
| LogP | 4.96360 |
| Index of Refraction | 1.614 |
| InChIKey | ZNKZJCICBFSACN-GBESFXJTSA-N |
| SMILES | CC(C)CC(NC(=O)C(N)C(C)C)C(=O)NC(CCCN=C(N)N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| D-VLR-PNA |
| D-Val-Leu-Arg-PNA |
| Val-Leu-Arg-p-nitroanilide |
| S2266 |
| D-Val-Leu-Arg-paranitroanilide |
| D-Valyl-leucyl-arginine-p-nitroanilide |
| H-D-Val-leu-arg-p-nitroanilide |