3-(1-nitrosoethylidene)-N-phenyl-1,2,4-thiadiazol-5-amine structure
|
Common Name | 3-(1-nitrosoethylidene)-N-phenyl-1,2,4-thiadiazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 64822-05-5 | Molecular Weight | 234.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(1-nitrosoethylidene)-N-phenyl-1,2,4-thiadiazol-5-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10N4OS |
|---|---|
| Molecular Weight | 234.27800 |
| Exact Mass | 234.05800 |
| PSA | 101.61000 |
| LogP | 1.81230 |
| InChIKey | REXSKLYLZGMAFL-NTUHNPAUSA-N |
| SMILES | CC(=NO)c1nsc(Nc2ccccc2)n1 |
|
~%
3-(1-nitrosoeth... CAS#:64822-05-5 |
| Literature: Vivona,N. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1616 - 1619 |
|
~%
3-(1-nitrosoeth... CAS#:64822-05-5 |
| Literature: Vivona,N. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1616 - 1619 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Acetyl-5-anilino-1,2,4-thiadiazol-Z-oxim |