7-[[[[4-acetamidophenyl]amino]carbonyl]amino]-4-hydroxynaphthalene-2-sulphonic acid structure
|
Common Name | 7-[[[[4-acetamidophenyl]amino]carbonyl]amino]-4-hydroxynaphthalene-2-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 6483-83-6 | Molecular Weight | 415.42000 | |
| Density | 1.608g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H17N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-[(4-acetamidophenyl)carbamoylamino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.608g/cm3 |
|---|---|
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.42000 |
| Exact Mass | 415.08400 |
| PSA | 153.21000 |
| LogP | 4.69430 |
| Index of Refraction | 1.757 |
| InChIKey | ZVUFRADFUYQPMB-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(NC(=O)Nc2ccc3c(O)cc(S(=O)(=O)O)cc3c2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
7-[[[[4-acetami... CAS#:6483-83-6 |
| Literature: Ges. f. chem. Ind. Patent: DE148505 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-Acetamino-phenyl)-N'-(5-oxy-7-sulfo-naphthyl-(1))-harnstoff |
| EINECS 229-345-7 |
| 7-[N'-(4-acetylamino-phenyl)-ureido]-4-hydroxy-naphthalene-2-sulfonic acid |
| 7-((((4-Acetamidophenyl)amino)carbonyl)amino)-4-hydroxynaphthalene-2-sulphonic acid |
| 7-({[(4-acetamidophenyl)amino]carbonyl}amino)-4-hydroxynaphthalene-2-sulfonic acid |
| 7-[N'-(4-Acetylamino-phenyl)-ureido]-4-hydroxy-naphthalin-2-sulfonsaeure |
| 7-{[(4-acetamidophenyl)carbamoyl]amino}-4-hydroxynaphthalene-2-sulfonic acid |