5,8-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid structure
|
Common Name | 5,8-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6483-85-8 | Molecular Weight | 320.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,8-dihydroxy-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H8O7S |
|---|---|
| Molecular Weight | 320.27400 |
| Exact Mass | 319.99900 |
| PSA | 137.35000 |
| LogP | 2.20070 |
| InChIKey | TUAYNBIXNNFSGQ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc(S(=O)(=O)O)cc2C(=O)c2c(O)ccc(O)c21 |
| HS Code | 2918990090 |
|---|
|
~%
5,8-dihydroxy-9... CAS#:6483-85-8 |
| Literature: Bayer and Co. Patent: DE84505 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 300 |
|
~%
5,8-dihydroxy-9... CAS#:6483-85-8 |
| Literature: Schwenk; Waldmann Angewandte Chemie, 1932 , vol. 45, p. 17,20 |
|
~%
5,8-dihydroxy-9... CAS#:6483-85-8 |
| Literature: Schwenk; Waldmann Angewandte Chemie, 1932 , vol. 45, p. 17,20 |
|
~%
5,8-dihydroxy-9... CAS#:6483-85-8 |
| Literature: I.G.Farbenind. Patent: DE492000 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 1247 |
|
~%
5,8-dihydroxy-9... CAS#:6483-85-8 |
| Literature: Bayer and Co. Patent: DE162035 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 8, p. 259 |
|
~%
5,8-dihydroxy-9... CAS#:6483-85-8 |
| Literature: B.A.S.F. Patent: DE216071 ; |
|
~%
5,8-dihydroxy-9... CAS#:6483-85-8 |
| Literature: I.G.Farbenind. Patent: DE492000 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 1247 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Chinizarin-sulfonsaeure-(6) |
| Chinizarin-6-sulfonsaeure |
| 5,8-Dihydroxy-9,10-dioxo-9,10-dihydro-anthracen-2-sulfonsaeure |
| 1.4-Dioxy-anthrachinon-sulfonsaeure-(6) |
| 5,8-dihydroxy-9,10-dioxo-9,10-dihydro-anthracene-2-sulfonic acid |