Methanone,(4-chlorophenyl)(5-chloro-1,3,4-thiadiazol-2-yl)- structure
|
Common Name | Methanone,(4-chlorophenyl)(5-chloro-1,3,4-thiadiazol-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 64837-44-1 | Molecular Weight | 259.11200 | |
| Density | 1.548g/cm3 | Boiling Point | 421.4ºC at 760mmHg | |
| Molecular Formula | C9H4Cl2N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | (4-chlorophenyl)-(5-chloro-1,3,4-thiadiazol-2-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.548g/cm3 |
|---|---|
| Boiling Point | 421.4ºC at 760mmHg |
| Molecular Formula | C9H4Cl2N2OS |
| Molecular Weight | 259.11200 |
| Flash Point | 208.6ºC |
| Exact Mass | 257.94200 |
| PSA | 71.09000 |
| LogP | 3.07590 |
| Index of Refraction | 1.641 |
| InChIKey | KKALKXPZWYMLPN-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1nnc(Cl)s1 |
|
~%
Methanone,(4-ch... CAS#:64837-44-1 |
| Literature: Demaree,P. et al. Canadian Journal of Chemistry, 1977 , vol. 55, p. 243 - 250 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (4-chloro-phenyl)-(5-chloro-[1,3,4]thiadiazol-2-yl)-methanone |
| 2-Chlor-5-(4-chlor-benzoyl)-1,3,4-thiadiazol |