ethyl 4-methyl-3-phenyl-1H-pyrazole-5-carboxylate structure
|
Common Name | ethyl 4-methyl-3-phenyl-1H-pyrazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 64847-20-7 | Molecular Weight | 230.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-methyl-3-phenyl-1H-pyrazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14N2O2 |
|---|---|
| Molecular Weight | 230.26200 |
| Exact Mass | 230.10600 |
| PSA | 54.98000 |
| LogP | 2.56180 |
| InChIKey | IUOXCSCGDQZQTG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]nc(-c2ccccc2)c1C |
|
~%
ethyl 4-methyl-... CAS#:64847-20-7 |
| Literature: Clerici, Francesca; Ferrario, Tiziano; Gelmi, Maria Luisa; Marelli, Roberto Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1994 , # 18 p. 2533 - 2536 |
| ethyl 4-methyl-5-phenyl-1H-pyrazole-3-carboxylate |
| ethyl 4-methyl-5-phenylpyrazole-3-carboxylate |
| 1H-Pyrazole-3-carboxylic acid,4-methyl-5-phenyl-,ethyl ester |