N-(3-(4-(2-Methylpropoxy)phenyl)-3-oxopropyl)glycine ethyl ester hydro chloride structure
|
Common Name | N-(3-(4-(2-Methylpropoxy)phenyl)-3-oxopropyl)glycine ethyl ester hydro chloride | ||
|---|---|---|---|---|
| CAS Number | 64875-82-7 | Molecular Weight | 343.84600 | |
| Density | N/A | Boiling Point | 430.2ºC at 760 mmHg | |
| Molecular Formula | C17H26ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214ºC | |
| Name | ethyl 2-[[3-[4-(2-methylpropoxy)phenyl]-3-oxopropyl]amino]acetate,hydrochloride |
|---|
| Boiling Point | 430.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H26ClNO4 |
| Molecular Weight | 343.84600 |
| Flash Point | 214ºC |
| Exact Mass | 343.15500 |
| PSA | 64.63000 |
| LogP | 3.63980 |
| InChIKey | RQLHMVZJZUNBFH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNCCC(=O)c1ccc(OCC(C)C)cc1.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |