1,2,4-Triazolidine-3,5-dione,4-phenyl-1-(1,1,2-trimethyl-2-propen-1-yl)- structure
|
Common Name | 1,2,4-Triazolidine-3,5-dione,4-phenyl-1-(1,1,2-trimethyl-2-propen-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 64891-99-2 | Molecular Weight | 259.30400 | |
| Density | 1.188g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,3-dimethylbut-3-en-2-yl)-4-phenyl-1,2,4-triazolidine-3,5-dione |
|---|
| Density | 1.188g/cm3 |
|---|---|
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.30400 |
| Exact Mass | 259.13200 |
| PSA | 59.79000 |
| LogP | 1.63850 |
| Index of Refraction | 1.568 |
| InChIKey | ZKLIVMVXJROSHY-UHFFFAOYSA-N |
| SMILES | C=C(C)C(C)(C)n1[nH]c(=O)n(-c2ccccc2)c1=O |
|
~0%
1,2,4-Triazolid... CAS#:64891-99-2 |
| Literature: Syrgiannis, Zois; Koutsianopoulos, Fotios; Muir, Kenneth W.; Elemes, Yiannis Tetrahedron Letters, 2009 , vol. 50, # 3 p. 277 - 280 |
|
~88%
1,2,4-Triazolid... CAS#:64891-99-2 |
| Literature: Ohashi, Shinichi; Leong, Koon-wah; Matyjaszewski, Kristoff; Butler, George B. Journal of Organic Chemistry, 1980 , vol. 45, # 17 p. 3467 - 3471 |
|
~%
Detail
|
| Literature: Elemes, Yiannis; Orfanopoulos, Michael Tetrahedron Letters, 1991 , vol. 32, # 23 p. 2667 - 2670 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |