Taurox SB structure
|
Common Name | Taurox SB | ||
|---|---|---|---|---|
| CAS Number | 648922-41-2 | Molecular Weight | 362.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O6S1/2Zn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Taurox SBTaurox SB can be used as a nontoxic, non-antimicrobial agent that can replace or supplement the use of antibiotics in the animal husbandry of livestock animals to increase health and general well-being, productivity, feed efficiency and weight gain. |
| Name | zinc,2-[3-(phenylmethoxycarbonylamino)propanoylamino]ethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Taurox SB can be used as a nontoxic, non-antimicrobial agent that can replace or supplement the use of antibiotics in the animal husbandry of livestock animals to increase health and general well-being, productivity, feed efficiency and weight gain. |
|---|---|
| Related Catalog | |
| In Vitro | Taurox SB can be used as a nontoxic, non-antimicrobial agent that can replace or supplement the use of antibiotics in the animal husbandry of livestock animals to increase health and general well-being, productivity, feed efficiency and weight gain. Taurox SB is useful in any animal raised as a pet or for food or to produce a desired product, including milk, wool, caviar, feathers, nails, fur, hooves. Increase products even if not increase efficiency[1]. |
| References |
| Molecular Formula | C13H18N2O6S1/2Zn |
|---|---|
| Molecular Weight | 362.32 |
| PSA | 279.98000 |
| LogP | 4.60730 |
| InChIKey | BUDABWMEOIGHJW-UHFFFAOYSA-L |
| SMILES | O=C(CCNC(=O)OCc1ccccc1)NCCS(=O)(=O)[O-].O=C(CCNC(=O)OCc1ccccc1)NCCS(=O)(=O)[O-].[Zn+2] |
| Cobat zinc salt |
| Zinc,bis(2-((1-(oxo-kappao)-3-(((phenylmethoxy)carbonyl)amino)propyl)amino)ethanesulfonato-kappao)-,(t-4) |
| Ethanesulfonic acid,2-((1-oxo-3-(((phenylmethoxy)carbonyl)amino)propyl)amino)-,zinc salt (2:1) |
| Zn salt of carbo-benzoxybetaalanyl taurine |
| Taurox SB |
| Tauroxicum |
| UNII-0W4D88Q9C4 |