1,4-Naphthalenedione,2-chloro-3-[(4-hydroxyphenyl)amino]- structure
|
Common Name | 1,4-Naphthalenedione,2-chloro-3-[(4-hydroxyphenyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 64897-00-3 | Molecular Weight | 299.70900 | |
| Density | 1.49g/cm3 | Boiling Point | 463.1ºC at 760 mmHg | |
| Molecular Formula | C16H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.9ºC | |
| Name | 2-chloro-3-(4-hydroxyanilino)naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 463.1ºC at 760 mmHg |
| Molecular Formula | C16H10ClNO3 |
| Molecular Weight | 299.70900 |
| Flash Point | 233.9ºC |
| Exact Mass | 299.03500 |
| PSA | 66.40000 |
| LogP | 3.40670 |
| Index of Refraction | 1.704 |
| InChIKey | BAPUUJSXNSGXLT-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(Nc2ccc(O)cc2)C(=O)c2ccccc21 |
| HS Code | 2922509090 |
|---|
|
~98%
1,4-Naphthalene... CAS#:64897-00-3 |
| Literature: Granot, Yossi; Bittner, Shmuel Patent: US2008/300274 A1, 2008 ; Location in patent: Page/Page column 7 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chloro-3-(4-hydroxyphenylamino)-1,4-naphthoquinone |
| 2-chloro-3-[(4-hydroxyphenyl)amino]naphthalene-1,4-dione |
| 1,4-Naphthalenedione,2-chloro-3-((4-hydroxyphenyl)amino) |
| 2-Chloro-3-(4-hydroxyanilino)naphthoquinone |