2-(benzenesulfonyl)azulene structure
|
Common Name | 2-(benzenesulfonyl)azulene | ||
|---|---|---|---|---|
| CAS Number | 64897-04-7 | Molecular Weight | 268.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(benzenesulfonyl)azulene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O2S |
|---|---|
| Molecular Weight | 268.33000 |
| Exact Mass | 268.05600 |
| PSA | 42.52000 |
| LogP | 4.70500 |
| InChIKey | WKPSSYUVTJCNGN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1cc2cccccc-2c1 |
|
~80%
2-(benzenesulfo... CAS#:64897-04-7 |
| Literature: Shibasaki, Toshihisa; Ooishi, Takeo; Yamanouchi, Nobuhiko; Murafuji, Toshihiro; Kurotobi, Kei; Sugihara, Yoshikazu Journal of Organic Chemistry, 2008 , vol. 73, # 20 p. 7971 - 7977 |
|
~44%
2-(benzenesulfo... CAS#:64897-04-7 |
| Literature: Shibasaki, Toshihisa; Ooishi, Takeo; Yamanouchi, Nobuhiko; Murafuji, Toshihiro; Kurotobi, Kei; Sugihara, Yoshikazu Journal of Organic Chemistry, 2008 , vol. 73, # 20 p. 7971 - 7977 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Phenylsulfonylazulen |
| Azulene,2-(phenylsulfonyl) |
| 2-azulenyl phenyl sulfone |