2-methylsulfanyl-2-morpholin-4-yl-3-phenyl-propanenitrile structure
|
Common Name | 2-methylsulfanyl-2-morpholin-4-yl-3-phenyl-propanenitrile | ||
|---|---|---|---|---|
| CAS Number | 64906-32-7 | Molecular Weight | 262.37100 | |
| Density | 1.177g/cm3 | Boiling Point | 385.7ºC at 760 mmHg | |
| Molecular Formula | C14H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187ºC | |
| Name | 2-methylsulfanyl-2-morpholin-4-yl-3-phenylpropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 385.7ºC at 760 mmHg |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.37100 |
| Flash Point | 187ºC |
| Exact Mass | 262.11400 |
| PSA | 61.56000 |
| LogP | 2.08208 |
| Index of Refraction | 1.58 |
| InChIKey | IKFPWDWSXLZGKX-UHFFFAOYSA-N |
| SMILES | CSC(C#N)(Cc1ccccc1)N1CCOCC1 |
|
~%
2-methylsulfany... CAS#:64906-32-7 |
| Literature: Okecha,S.A.; Stansfield,F. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1811 - 1814 |
|
~%
2-methylsulfany... CAS#:64906-32-7 |
| Literature: Okecha,S.A.; Stansfield,F. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1811 - 1814 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methylsulfanyl-2-morpholin-4-yl-3-phenyl-propionitrile |