8-(2-ethynylphenyl)octa-3,5,7-trien-2-one structure
|
Common Name | 8-(2-ethynylphenyl)octa-3,5,7-trien-2-one | ||
|---|---|---|---|---|
| CAS Number | 64924-26-1 | Molecular Weight | 222.28200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-(2-ethynylphenyl)octa-3,5,7-trien-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14O |
|---|---|
| Molecular Weight | 222.28200 |
| Exact Mass | 222.10400 |
| PSA | 17.07000 |
| LogP | 3.38250 |
| InChIKey | HLVOJHHNUSNDGD-UHFFFAOYSA-N |
| SMILES | C#Cc1ccccc1C=CC=CC=CC(C)=O |
|
~%
8-(2-ethynylphe... CAS#:64924-26-1 |
| Literature: Ojima, Juro; Nakagawa, Yukiko; Wada, Kazuyo; Terasaki, Masayuki Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , p. 43 - 50 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-(o-ethynylphenyl)-3,5,7-octatrien-2-one |
| 3,5,7-Octatrien-2-one,8-(2-ethynylphenyl)-,(E,E,E) |
| 8-(o-Ethinylphenyl)-octa-3,5,7-trien-2-on |