1-(3-Carboxypropyl)-3,7-dimethylxanthine structure
|
Common Name | 1-(3-Carboxypropyl)-3,7-dimethylxanthine | ||
|---|---|---|---|---|
| CAS Number | 6493-07-8 | Molecular Weight | 266.25300 | |
| Density | 1.5g/cm3 | Boiling Point | 575.6ºC at 760 mmHg | |
| Molecular Formula | C11H14N4O4 | Melting Point | 208-210ºC | |
| MSDS | Chinese USA | Flash Point | 301.9ºC | |
| Name | 1-(3-Carboxypropyl)-3,7-dimethylxanthine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 575.6ºC at 760 mmHg |
| Melting Point | 208-210ºC |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.25300 |
| Flash Point | 301.9ºC |
| Exact Mass | 266.10200 |
| PSA | 99.12000 |
| Index of Refraction | 1.668 |
| InChIKey | WKASGTGXOGALBG-UHFFFAOYSA-N |
| SMILES | Cn1cnc2c1c(=O)n(CCCC(=O)O)c(=O)n2C |
| RIDADR | NONH for all modes of transport |
|---|
|
~%
1-(3-Carboxypro... CAS#:6493-07-8 |
| Literature: Cottam, Howard B.; Shih, Hsiencheng; Tehrani, Lida R.; Wasson, D. Bruce; Carson, Dennis A. Journal of Medicinal Chemistry, 1996 , vol. 39, # 1 p. 2 - 9 |
|
~%
1-(3-Carboxypro... CAS#:6493-07-8 |
| Literature: Cottam, Howard B.; Shih, Hsiencheng; Tehrani, Lida R.; Wasson, D. Bruce; Carson, Dennis A. Journal of Medicinal Chemistry, 1996 , vol. 39, # 1 p. 2 - 9 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(3,7-dimethyl-2,6-dioxopurin-1-yl)butanoic acid |