Acetamide,N-[5-(1-methylethyl)-4-nitro-2-thiazolyl]- structure
|
Common Name | Acetamide,N-[5-(1-methylethyl)-4-nitro-2-thiazolyl]- | ||
|---|---|---|---|---|
| CAS Number | 64932-40-7 | Molecular Weight | 229.25600 | |
| Density | 1.371g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H11N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-nitro-5-propan-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.25600 |
| Exact Mass | 229.05200 |
| PSA | 116.05000 |
| LogP | 2.72930 |
| Index of Refraction | 1.607 |
| InChIKey | MQJYZAARBLQFHC-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1nc([N+](=O)[O-])c(C(C)C)s1 |
|
~%
Acetamide,N-[5-... CAS#:64932-40-7 |
| Literature: Grehn,L. Journal of Heterocyclic Chemistry, 1977 , vol. 14, p. 917 - 919 |
|
~%
Acetamide,N-[5-... CAS#:64932-40-7 |
| Literature: Grehn,L. Journal of Heterocyclic Chemistry, 1977 , vol. 14, p. 917 - 919 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Acetamide,N-[5-(1-methylethyl)-4-nitro-2-thiazolyl] |
| N-(5-isopropyl-4-nitro-thiazol-2-yl)-acetamide |