2H-1,2,4-Benzothiadiazine-3-carboxylicacid, 7-(aminosulfonyl)-6-chloro-2-ethyl-3,4-dihydro-, 1,1-dioxide structure
|
Common Name | 2H-1,2,4-Benzothiadiazine-3-carboxylicacid, 7-(aminosulfonyl)-6-chloro-2-ethyl-3,4-dihydro-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 64932-76-9 | Molecular Weight | 369.80200 | |
| Density | 1.675g/cm3 | Boiling Point | 673ºC at 760mmHg | |
| Molecular Formula | C10H12ClN3O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.8ºC | |
| Name | 6-chloro-2-ethyl-1,1-dioxo-7-sulfamoyl-3,4-dihydro-1λ6,2,4-benzothiadiazine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.675g/cm3 |
|---|---|
| Boiling Point | 673ºC at 760mmHg |
| Molecular Formula | C10H12ClN3O6S2 |
| Molecular Weight | 369.80200 |
| Flash Point | 360.8ºC |
| Exact Mass | 368.98600 |
| PSA | 163.63000 |
| LogP | 2.77200 |
| Index of Refraction | 1.629 |
| InChIKey | TVPQERYORAWVJW-UHFFFAOYSA-N |
| SMILES | CCN1C(C(=O)O)Nc2cc(Cl)c(S(N)(=O)=O)cc2S1(=O)=O |
|
~%
2H-1,2,4-Benzot... CAS#:64932-76-9 |
| Literature: Close,W.J. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 3423 - 3428 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-chloro-2-ethyl-1,1-dioxo-7-sulfamoyl-3,4-dihydro-1 |
| 6-Chlor-7-sulfamoyl-2-ethyl-3-carboxy-3.4-dihydro-2H-1.2.4-benzothiadiazin-1.1-dioxid |